About 3-pentyl-1,3-thiazolidine-4-carboxylic acid
3-pentyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 68916586) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is 3-pentyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-pentyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 68916586 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 3-pentyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCN1CSCC1C(=O)O |
| InChI | InChI=1S/C9H17NO2S/c1-2-3-4-5-10-7-13-6-8(10)9(11)12/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | AGLKHFAUKBYYOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-pentyl-1,3-thiazolidine-4-carboxylic acid (CID 68916586) is 3-pentyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-pentyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-pentyl-1,3-thiazolidine-4-carboxylic acid is CCCCCN1CSCC1C(=O)O.
What is the InChIKey of 3-pentyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is AGLKHFAUKBYYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-2-3-4-5-10-7-13-6-8(10)9(11)12/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 3-pentyl-1,3-thiazolidine-4-carboxylic acid?
3-pentyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 203.31 g/mol, XLogP of 1.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 68916586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).