About 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride
5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 68916606) has the molecular formula C12H14ClN3O3
and a molecular weight of 283.72 g/mol. Its IUPAC name is 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride |
| PubChem CID | 68916606 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cc1noc2cc(N3CC(CN)OC3=O)ccc12.Cl |
| InChI | InChI=1S/C12H13N3O3.ClH/c1-7-10-3-2-8(4-11(10)18-14-7)15-6-9(5-13)17-12(15)16;/h2-4,9H,5-6,13H2,1H3;1H |
| InChIKey | ASTSDJUYBMLMCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride?
The IUPAC name of 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride (CID 68916606) is 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride.
What is the SMILES notation for 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride?
The canonical SMILES for 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride is Cc1noc2cc(N3CC(CN)OC3=O)ccc12.Cl.
What is the InChIKey of 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride?
The InChIKey is ASTSDJUYBMLMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3.ClH/c1-7-10-3-2-8(4-11(10)18-14-7)15-6-9(5-13)17-12(15)16;/h2-4,9H,5-6,13H2,1H3;1H.
What are the key properties of 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride?
5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride has a molecular weight of 283.72 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-3-(3-methyl-1,2-benzoxazol-6-yl)-1,3-oxazolidin-2-one;hydrochloride is sourced from PubChem (CID 68916606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).