C23H25BrO3 — CID 68918841
3-[4-(1-bromocyclohexanecarbonyl)phenyl]-3-phenylbutanoic acid (PubChem CID 68918841) has the molecular formula C23H25BrO3 and a molecular weight of 429.35 g/mol. Its IUPAC name is 3-[4-(1-bromocyclohexanecarbonyl)phenyl]-3-phenylbutanoic acid.
| Compound Name | 3-[4-(1-bromocyclohexanecarbonyl)phenyl]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 68918841 |
| Molecular Formula | C23H25BrO3 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[4-(1-bromocyclohexanecarbonyl)phenyl]-3-phenylbutanoic acid |
| SMILES | CC(CC(=O)O)(c1ccccc1)c1ccc(C(=O)C2(Br)CCCCC2)cc1 |
| InChI | InChI=1S/C23H25BrO3/c1-22(16-20(25)26,18-8-4-2-5-9-18)19-12-10-17(11-13-19)21(27)23(24)14-6-3-7-15-23/h2,4-5,8-13H,3,6-7,14-16H2,1H3,(H,25,26) |
| InChIKey | JIRCIXLVRQBQAE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|