C24H32O4 — CID 139605185
3,3-bis[3-(1-hydroxy-2-methylpropan-2-yl)phenyl]butanoic acid (PubChem CID 139605185) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3,3-bis[3-(1-hydroxy-2-methylpropan-2-yl)phenyl]butanoic acid.
| Compound Name | 3,3-bis[3-(1-hydroxy-2-methylpropan-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 139605185 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3,3-bis[3-(1-hydroxy-2-methylpropan-2-yl)phenyl]butanoic acid |
| SMILES | CC(C)(CO)c1cccc(C(C)(CC(=O)O)c2cccc(C(C)(C)CO)c2)c1 |
| InChI | InChI=1S/C24H32O4/c1-22(2,15-25)17-8-6-10-19(12-17)24(5,14-21(27)28)20-11-7-9-18(13-20)23(3,4)16-26/h6-13,25-26H,14-16H2,1-5H3,(H,27,28) |
| InChIKey | BNZKXXYSDIDZPE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |