C17H26O3 — CID 151387758
3-(3-tert-butylphenyl)-3-hydroxy-4,4-dimethylpentanoic acid (PubChem CID 151387758) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-(3-tert-butylphenyl)-3-hydroxy-4,4-dimethylpentanoic acid.
| Compound Name | 3-(3-tert-butylphenyl)-3-hydroxy-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 151387758 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-(3-tert-butylphenyl)-3-hydroxy-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)c1cccc(C(O)(CC(=O)O)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O3/c1-15(2,3)12-8-7-9-13(10-12)17(20,11-14(18)19)16(4,5)6/h7-10,20H,11H2,1-6H3,(H,18,19) |
| InChIKey | OTTWBPXXCDLRSM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |