C22H40O — CID 68923292
5-decyl-5-methyl-2-pentylcyclohexa-1,3-dien-1-ol (PubChem CID 68923292) has the molecular formula C22H40O and a molecular weight of 320.56 g/mol. Its IUPAC name is 5-decyl-5-methyl-2-pentylcyclohexa-1,3-dien-1-ol.
| Compound Name | 5-decyl-5-methyl-2-pentylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 68923292 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | 5-decyl-5-methyl-2-pentylcyclohexa-1,3-dien-1-ol |
| SMILES | CCCCCCCCCCC1(C)C=CC(CCCCC)=C(O)C1 |
| InChI | InChI=1S/C22H40O/c1-4-6-8-9-10-11-12-14-17-22(3)18-16-20(21(23)19-22)15-13-7-5-2/h16,18,23H,4-15,17,19H2,1-3H3 |
| InChIKey | QRLGMENHVPXRLD-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|