C33H56O2 — CID 67823707
2-[(2-hydroxy-5-methyl-5-nonylcyclohexa-1,3-dien-1-yl)methyl]-4-methyl-4-nonylcyclohexa-1,5-dien-1-ol (PubChem CID 67823707) has the molecular formula C33H56O2 and a molecular weight of 484.81 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-methyl-5-nonylcyclohexa-1,3-dien-1-yl)methyl]-4-methyl-4-nonylcyclohexa-1,5-dien-1-ol.
| Compound Name | 2-[(2-hydroxy-5-methyl-5-nonylcyclohexa-1,3-dien-1-yl)methyl]-4-methyl-4-nonylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 67823707 |
| Molecular Formula | C33H56O2 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.43 |
| IUPAC Name | 2-[(2-hydroxy-5-methyl-5-nonylcyclohexa-1,3-dien-1-yl)methyl]-4-methyl-4-nonylcyclohexa-1,5-dien-1-ol |
| SMILES | CCCCCCCCCC1(C)C=CC(O)=C(CC2=C(O)C=CC(C)(CCCCCCCCC)C2)C1 |
| InChI | InChI=1S/C33H56O2/c1-5-7-9-11-13-15-17-21-32(3)23-19-30(34)28(26-32)25-29-27-33(4,24-20-31(29)35)22-18-16-14-12-10-8-6-2/h19-20,23-24,34-35H,5-18,21-22,25-27H2,1-4H3 |
| InChIKey | KSIDJHPYXMHJOV-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|