C17H21ClN2O3 — CID 68928997
tert-butyl 3-[(2-chloro-6-cyanophenyl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 68928997) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is tert-butyl 3-[(2-chloro-6-cyanophenyl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-chloro-6-cyanophenyl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68928997 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | tert-butyl 3-[(2-chloro-6-cyanophenyl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCc2c(Cl)cccc2C#N)C1 |
| InChI | InChI=1S/C17H21ClN2O3/c1-17(2,3)23-16(21)20-8-7-13(10-20)22-11-14-12(9-19)5-4-6-15(14)18/h4-6,13H,7-8,10-11H2,1-3H3 |
| InChIKey | MKBXFLGCUBJBQY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |