C11H8N2 — CID 68933601
7H-pyrrolo[3,4-h]quinoline (PubChem CID 68933601) has the molecular formula C11H8N2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 7H-pyrrolo[3,4-h]quinoline.
| Compound Name | 7H-pyrrolo[3,4-h]quinoline |
|---|---|
| PubChem CID | 68933601 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 7H-pyrrolo[3,4-h]quinoline |
| SMILES | C1=NCc2ccc3cccnc3c21 |
| InChI | InChI=1S/C11H8N2/c1-2-8-3-4-9-6-12-7-10(9)11(8)13-5-1/h1-5,7H,6H2 |
| InChIKey | ZWEKZCQHTNXEBL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |