C16H16N2OSi — CID 68936789
8-(2-trimethylsilylethynyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one (PubChem CID 68936789) has the molecular formula C16H16N2OSi and a molecular weight of 280.40 g/mol. Its IUPAC name is 8-(2-trimethylsilylethynyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one.
| Compound Name | 8-(2-trimethylsilylethynyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 68936789 |
| Molecular Formula | C16H16N2OSi |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 8-(2-trimethylsilylethynyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one |
| SMILES | C[Si](C)(C)C#Cc1ccc2[nH]c(=O)c3[nH]ccc3c2c1 |
| InChI | InChI=1S/C16H16N2OSi/c1-20(2,3)9-7-11-4-5-14-13(10-11)12-6-8-17-15(12)16(19)18-14/h4-6,8,10,17H,1-3H3,(H,18,19) |
| InChIKey | WTTIROFLOXCESO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|