C15H8BrF3N2O2 — CID 68936884
[3-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 68936884) has the molecular formula C15H8BrF3N2O2 and a molecular weight of 385.14 g/mol. Its IUPAC name is [3-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68936884 |
| Molecular Formula | C15H8BrF3N2O2 |
| Molecular Weight | 385.14 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | [3-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc(-c2cnc3[nH]cc(Br)c3c2)c1)C(F)(F)F |
| InChI | InChI=1S/C15H8BrF3N2O2/c16-12-7-21-13-11(12)5-9(6-20-13)8-2-1-3-10(4-8)23-14(22)15(17,18)19/h1-7H,(H,20,21) |
| InChIKey | FSXOBYSNNCTELA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|