About 1H-imidazole;2-iodo-2-methylheptane
1H-imidazole;2-iodo-2-methylheptane (PubChem CID 68937236) has the molecular formula C11H21IN2
and a molecular weight of 308.21 g/mol. Its IUPAC name is 1H-imidazole;2-iodo-2-methylheptane.
Molecular Properties
| Compound Name | 1H-imidazole;2-iodo-2-methylheptane |
| PubChem CID | 68937236 |
| Molecular Formula | C11H21IN2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1H-imidazole;2-iodo-2-methylheptane |
| SMILES | CCCCCC(C)(C)I.c1c[nH]cn1 |
| InChI | InChI=1S/C8H17I.C3H4N2/c1-4-5-6-7-8(2,3)9;1-2-5-3-4-1/h4-7H2,1-3H3;1-3H,(H,4,5) |
| InChIKey | BSHJDAQLRUGHMR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;2-iodo-2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;2-iodo-2-methylheptane?
The IUPAC name of 1H-imidazole;2-iodo-2-methylheptane (CID 68937236) is 1H-imidazole;2-iodo-2-methylheptane.
What is the SMILES notation for 1H-imidazole;2-iodo-2-methylheptane?
The canonical SMILES for 1H-imidazole;2-iodo-2-methylheptane is CCCCCC(C)(C)I.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;2-iodo-2-methylheptane?
The InChIKey is BSHJDAQLRUGHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17I.C3H4N2/c1-4-5-6-7-8(2,3)9;1-2-5-3-4-1/h4-7H2,1-3H3;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;2-iodo-2-methylheptane?
1H-imidazole;2-iodo-2-methylheptane has a molecular weight of 308.21 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;2-iodo-2-methylheptane is sourced from PubChem (CID 68937236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).