About 2-amino-2-methylhexanoic acid;1H-imidazole
2-amino-2-methylhexanoic acid;1H-imidazole (PubChem CID 175490128) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-amino-2-methylhexanoic acid;1H-imidazole.
Molecular Properties
| Compound Name | 2-amino-2-methylhexanoic acid;1H-imidazole |
| PubChem CID | 175490128 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-amino-2-methylhexanoic acid;1H-imidazole |
| SMILES | CCCCC(C)(N)C(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C7H15NO2.C3H4N2/c1-3-4-5-7(2,8)6(9)10;1-2-5-3-4-1/h3-5,8H2,1-2H3,(H,9,10);1-3H,(H,4,5) |
| InChIKey | HVJCEAGFGDJJBP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-2-methylhexanoic acid;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methylhexanoic acid;1H-imidazole?
The IUPAC name of 2-amino-2-methylhexanoic acid;1H-imidazole (CID 175490128) is 2-amino-2-methylhexanoic acid;1H-imidazole.
What is the SMILES notation for 2-amino-2-methylhexanoic acid;1H-imidazole?
The canonical SMILES for 2-amino-2-methylhexanoic acid;1H-imidazole is CCCCC(C)(N)C(=O)O.c1c[nH]cn1.
What is the InChIKey of 2-amino-2-methylhexanoic acid;1H-imidazole?
The InChIKey is HVJCEAGFGDJJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C3H4N2/c1-3-4-5-7(2,8)6(9)10;1-2-5-3-4-1/h3-5,8H2,1-2H3,(H,9,10);1-3H,(H,4,5).
What are the key properties of 2-amino-2-methylhexanoic acid;1H-imidazole?
2-amino-2-methylhexanoic acid;1H-imidazole has a molecular weight of 213.28 g/mol, XLogP of 1.39, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methylhexanoic acid;1H-imidazole is sourced from PubChem (CID 175490128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).