About 1H-imidazole;octan-2-amine
1H-imidazole;octan-2-amine (PubChem CID 22649828) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 1H-imidazole;octan-2-amine.
Molecular Properties
| Compound Name | 1H-imidazole;octan-2-amine |
| PubChem CID | 22649828 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1H-imidazole;octan-2-amine |
| SMILES | CCCCCCC(C)N.c1c[nH]cn1 |
| InChI | InChI=1S/C8H19N.C3H4N2/c1-3-4-5-6-7-8(2)9;1-2-5-3-4-1/h8H,3-7,9H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | JPFNURXBZLVAGI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;octan-2-amine?
The IUPAC name of 1H-imidazole;octan-2-amine (CID 22649828) is 1H-imidazole;octan-2-amine.
What is the SMILES notation for 1H-imidazole;octan-2-amine?
The canonical SMILES for 1H-imidazole;octan-2-amine is CCCCCCC(C)N.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;octan-2-amine?
The InChIKey is JPFNURXBZLVAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H4N2/c1-3-4-5-6-7-8(2)9;1-2-5-3-4-1/h8H,3-7,9H2,1-2H3;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;octan-2-amine?
1H-imidazole;octan-2-amine has a molecular weight of 197.33 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;octan-2-amine is sourced from PubChem (CID 22649828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).