About 1H-imidazole;nonadecan-4-yl iodate
1H-imidazole;nonadecan-4-yl iodate (PubChem CID 162220747) has the molecular formula C22H43IN2O3
and a molecular weight of 510.50 g/mol. Its IUPAC name is 1H-imidazole;nonadecan-4-yl iodate.
Molecular Properties
| Compound Name | 1H-imidazole;nonadecan-4-yl iodate |
| PubChem CID | 162220747 |
| Molecular Formula | C22H43IN2O3 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 1H-imidazole;nonadecan-4-yl iodate |
| SMILES | CCCCCCCCCCCCCCCC(CCC)O[I+2]([O-])[O-].c1c[nH]cn1 |
| InChI | InChI=1S/C19H39IO3.C3H4N2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-19(17-4-2)23-20(21)22;1-2-5-3-4-1/h19H,3-18H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | ZUBXCXFMXVGMGC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;nonadecan-4-yl iodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;nonadecan-4-yl iodate?
The IUPAC name of 1H-imidazole;nonadecan-4-yl iodate (CID 162220747) is 1H-imidazole;nonadecan-4-yl iodate.
What is the SMILES notation for 1H-imidazole;nonadecan-4-yl iodate?
The canonical SMILES for 1H-imidazole;nonadecan-4-yl iodate is CCCCCCCCCCCCCCCC(CCC)O[I+2]([O-])[O-].c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;nonadecan-4-yl iodate?
The InChIKey is ZUBXCXFMXVGMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39IO3.C3H4N2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-19(17-4-2)23-20(21)22;1-2-5-3-4-1/h19H,3-18H2,1-2H3;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;nonadecan-4-yl iodate?
1H-imidazole;nonadecan-4-yl iodate has a molecular weight of 510.50 g/mol, XLogP of 2.15, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;nonadecan-4-yl iodate is sourced from PubChem (CID 162220747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).