About anisole;1H-imidazole;methyl(trioctyl)phosphanium
anisole;1H-imidazole;methyl(trioctyl)phosphanium (PubChem CID 174834352) has the molecular formula C35H66N2OP+
and a molecular weight of 561.90 g/mol. Its IUPAC name is anisole;1H-imidazole;methyl(trioctyl)phosphanium.
Molecular Properties
| Compound Name | anisole;1H-imidazole;methyl(trioctyl)phosphanium |
| PubChem CID | 174834352 |
| Molecular Formula | C35H66N2OP+ |
| Molecular Weight | 561.90 g/mol |
| Exact Mass | 561.49 |
| IUPAC Name | anisole;1H-imidazole;methyl(trioctyl)phosphanium |
| SMILES | CCCCCCCC[P+](C)(CCCCCCCC)CCCCCCCC.COc1ccccc1.c1c[nH]cn1 |
| InChI | InChI=1S/C25H54P.C7H8O.C3H4N2/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-8-7-5-3-2-4-6-7;1-2-5-3-4-1/h5-25H2,1-4H3;2-6H,1H3;1-3H,(H,4,5)/q+1;; |
| InChIKey | UFVHQKVDTPWWJW-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.90 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze anisole;1H-imidazole;methyl(trioctyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1H-imidazole;methyl(trioctyl)phosphanium?
The IUPAC name of anisole;1H-imidazole;methyl(trioctyl)phosphanium (CID 174834352) is anisole;1H-imidazole;methyl(trioctyl)phosphanium.
What is the SMILES notation for anisole;1H-imidazole;methyl(trioctyl)phosphanium?
The canonical SMILES for anisole;1H-imidazole;methyl(trioctyl)phosphanium is CCCCCCCC[P+](C)(CCCCCCCC)CCCCCCCC.COc1ccccc1.c1c[nH]cn1.
What is the InChIKey of anisole;1H-imidazole;methyl(trioctyl)phosphanium?
The InChIKey is UFVHQKVDTPWWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H54P.C7H8O.C3H4N2/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-8-7-5-3-2-4-6-7;1-2-5-3-4-1/h5-25H2,1-4H3;2-6H,1H3;1-3H,(H,4,5)/q+1;;.
What are the key properties of anisole;1H-imidazole;methyl(trioctyl)phosphanium?
anisole;1H-imidazole;methyl(trioctyl)phosphanium has a molecular weight of 561.90 g/mol, XLogP of 11.82, 22 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1H-imidazole;methyl(trioctyl)phosphanium is sourced from PubChem (CID 174834352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).