About (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one
(3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one (PubChem CID 68940202) has the molecular formula C5H7F2NO2
and a molecular weight of 151.11 g/mol. Its IUPAC name is (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one |
| PubChem CID | 68940202 |
| Molecular Formula | C5H7F2NO2 |
| Molecular Weight | 151.11 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one |
| SMILES | CC(F)(F)[C@H]1NC(=O)[C@H]1O |
| InChI | InChI=1S/C5H7F2NO2/c1-5(6,7)3-2(9)4(10)8-3/h2-3,9H,1H3,(H,8,10)/t2-,3-/m0/s1 |
| InChIKey | UULOVAWCQHDYMO-HRFVKAFMSA-N |
| XLogP | -0.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.11 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one?
The IUPAC name of (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one (CID 68940202) is (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one.
What is the SMILES notation for (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one?
The canonical SMILES for (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one is CC(F)(F)[C@H]1NC(=O)[C@H]1O.
What is the InChIKey of (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one?
The InChIKey is UULOVAWCQHDYMO-HRFVKAFMSA-N. The full InChI is InChI=1S/C5H7F2NO2/c1-5(6,7)3-2(9)4(10)8-3/h2-3,9H,1H3,(H,8,10)/t2-,3-/m0/s1.
What are the key properties of (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one?
(3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one has a molecular weight of 151.11 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(1,1-difluoroethyl)-3-hydroxyazetidin-2-one is sourced from PubChem (CID 68940202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).