C18H17BrN2O5S — CID 68942768
(Z)-N-(4-bromophenyl)-1-cyano-2-(2,3,4-trimethoxyphenyl)ethenesulfonamide (PubChem CID 68942768) has the molecular formula C18H17BrN2O5S and a molecular weight of 453.31 g/mol. Its IUPAC name is (Z)-N-(4-bromophenyl)-1-cyano-2-(2,3,4-trimethoxyphenyl)ethenesulfonamide.
| Compound Name | (Z)-N-(4-bromophenyl)-1-cyano-2-(2,3,4-trimethoxyphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 68942768 |
| Molecular Formula | C18H17BrN2O5S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | (Z)-N-(4-bromophenyl)-1-cyano-2-(2,3,4-trimethoxyphenyl)ethenesulfonamide |
| SMILES | COc1ccc(/C=C(/C#N)S(=O)(=O)Nc2ccc(Br)cc2)c(OC)c1OC |
| InChI | InChI=1S/C18H17BrN2O5S/c1-24-16-9-4-12(17(25-2)18(16)26-3)10-15(11-20)27(22,23)21-14-7-5-13(19)6-8-14/h4-10,21H,1-3H3/b15-10- |
| InChIKey | ULBASNINMOMCFU-GDNBJRDFSA-N |
| XLogP | 3.78 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|