C11H15N3O3 — CID 68944588
2-[benzylcarbamoyl(methylamino)amino]acetic acid (PubChem CID 68944588) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-[benzylcarbamoyl(methylamino)amino]acetic acid.
| Compound Name | 2-[benzylcarbamoyl(methylamino)amino]acetic acid |
|---|---|
| PubChem CID | 68944588 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[benzylcarbamoyl(methylamino)amino]acetic acid |
| SMILES | CNN(CC(=O)O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H15N3O3/c1-12-14(8-10(15)16)11(17)13-7-9-5-3-2-4-6-9/h2-6,12H,7-8H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | DYRIAMLDROUPMB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|