C16H21NO2 — CID 68947287
(4aR)-1-prop-2-enyl-3,4,4a,5,5a,6-hexahydro-2H-benzo[g]quinoline-6,7-diol (PubChem CID 68947287) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (4aR)-1-prop-2-enyl-3,4,4a,5,5a,6-hexahydro-2H-benzo[g]quinoline-6,7-diol.
| Compound Name | (4aR)-1-prop-2-enyl-3,4,4a,5,5a,6-hexahydro-2H-benzo[g]quinoline-6,7-diol |
|---|---|
| PubChem CID | 68947287 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (4aR)-1-prop-2-enyl-3,4,4a,5,5a,6-hexahydro-2H-benzo[g]quinoline-6,7-diol |
| SMILES | C=CCN1CCC[C@@H]2CC3C(=CC=C(O)C3O)C=C21 |
| InChI | InChI=1S/C16H21NO2/c1-2-7-17-8-3-4-12-9-13-11(10-14(12)17)5-6-15(18)16(13)19/h2,5-6,10,12-13,16,18-19H,1,3-4,7-9H2/t12-,13?,16?/m1/s1 |
| InChIKey | XTEFGGZRITXGMH-VEAWUBTESA-N |
| XLogP | 2.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|