C21H30N2O — CID 70542858
bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol (PubChem CID 70542858) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol.
| Compound Name | bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol |
|---|---|
| PubChem CID | 70542858 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | bis(1-methyl-3,4,4a,5-tetrahydro-2H-quinolin-6-yl)methanol |
| SMILES | CN1CCCC2CC(C(O)C3=CC=C4C(CCCN4C)C3)=CC=C21 |
| InChI | InChI=1S/C21H30N2O/c1-22-11-3-5-15-13-17(7-9-19(15)22)21(24)18-8-10-20-16(14-18)6-4-12-23(20)2/h7-10,15-16,21,24H,3-6,11-14H2,1-2H3 |
| InChIKey | VLVCQMHBBRHBLW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |