About 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one
4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one (PubChem CID 68947763) has the molecular formula C20H26O3S
and a molecular weight of 346.49 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one |
| PubChem CID | 68947763 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one |
| SMILES | COc1ccc2sc(C(=O)C(C)(C)C)c(CC(C)(C)C(C)=O)c2c1 |
| InChI | InChI=1S/C20H26O3S/c1-12(21)20(5,6)11-15-14-10-13(23-7)8-9-16(14)24-17(15)18(22)19(2,3)4/h8-10H,11H2,1-7H3 |
| InChIKey | XCXPUZHHPFNCEH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one?
The IUPAC name of 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one (CID 68947763) is 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one?
The canonical SMILES for 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one is COc1ccc2sc(C(=O)C(C)(C)C)c(CC(C)(C)C(C)=O)c2c1.
What is the InChIKey of 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one?
The InChIKey is XCXPUZHHPFNCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O3S/c1-12(21)20(5,6)11-15-14-10-13(23-7)8-9-16(14)24-17(15)18(22)19(2,3)4/h8-10H,11H2,1-7H3.
What are the key properties of 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one?
4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one has a molecular weight of 346.49 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,2-dimethylpropanoyl)-5-methoxy-1-benzothiophen-3-yl]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 68947763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).