C22H28O4 — CID 68950813
methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate (PubChem CID 68950813) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate.
| Compound Name | methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate |
|---|---|
| PubChem CID | 68950813 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate |
| SMILES | CCCCOCCOc1cc(C)c(-c2ccc(C(=O)OC)cc2)cc1C |
| InChI | InChI=1S/C22H28O4/c1-5-6-11-25-12-13-26-21-15-16(2)20(14-17(21)3)18-7-9-19(10-8-18)22(23)24-4/h7-10,14-15H,5-6,11-13H2,1-4H3 |
| InChIKey | QAEGSWQEEVCJTM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|