methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate

C22H28O4 — CID 68950813

IUPACmethyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate
SMILESCCCCOCCOc1cc(C)c(-c2ccc(C(=O)OC)cc2)cc1C
InChIInChI=1S/C22H28O4/c1-5-6-11-25-12-13-26-21-15-16(2)20(14-17(21)3)18-7-9-19(10-8-18)22(23)24-4/h7-10,14-15H,5-6,11-13H2,1-4H3
InChIKeyQAEGSWQEEVCJTM-UHFFFAOYSA-N
MW356.46 g/mol
LogP4.95
Rot. Bonds9

About methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate

methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate (PubChem CID 68950813) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate
PubChem CID68950813
Molecular FormulaC22H28O4
Molecular Weight356.46 g/mol
Exact Mass356.20
IUPAC Namemethyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate
SMILESCCCCOCCOc1cc(C)c(-c2ccc(C(=O)OC)cc2)cc1C
InChIInChI=1S/C22H28O4/c1-5-6-11-25-12-13-26-21-15-16(2)20(14-17(21)3)18-7-9-19(10-8-18)22(23)24-4/h7-10,14-15H,5-6,11-13H2,1-4H3
InChIKeyQAEGSWQEEVCJTM-UHFFFAOYSA-N
XLogP4.95
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.46
LogP ≤ 54.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate?
The IUPAC name of methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate (CID 68950813) is methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate.
What is the SMILES notation for methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate?
The canonical SMILES for methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate is CCCCOCCOc1cc(C)c(-c2ccc(C(=O)OC)cc2)cc1C.
What is the InChIKey of methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate?
The InChIKey is QAEGSWQEEVCJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O4/c1-5-6-11-25-12-13-26-21-15-16(2)20(14-17(21)3)18-7-9-19(10-8-18)22(23)24-4/h7-10,14-15H,5-6,11-13H2,1-4H3.
What are the key properties of methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate?
methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate has a molecular weight of 356.46 g/mol, XLogP of 4.95, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(2-butoxyethoxy)-2,5-dimethylphenyl]benzoate is sourced from PubChem (CID 68950813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).