C27H28Cl2FN3O4 — CID 68951633
(3R)-6,8-dichloro-3-[[2-[[2-(3-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 68951633) has the molecular formula C27H28Cl2FN3O4 and a molecular weight of 548.44 g/mol. Its IUPAC name is (3R)-6,8-dichloro-3-[[2-[[2-(3-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | (3R)-6,8-dichloro-3-[[2-[[2-(3-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 68951633 |
| Molecular Formula | C27H28Cl2FN3O4 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | (3R)-6,8-dichloro-3-[[2-[[2-(3-fluorophenyl)acetyl]amino]-3-methylpentanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCC(C)C(NC(=O)Cc1cccc(F)c1)C(=O)N[C@]1(C(=O)O)CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C27H28Cl2FN3O4/c1-3-14(2)23(32-22(34)10-15-5-4-6-17(30)9-15)25(35)33-27(26(36)37)8-7-21-19(13-27)18-11-16(28)12-20(29)24(18)31-21/h4-6,9,11-12,14,23,31H,3,7-8,10,13H2,1-2H3,(H,32,34)(H,33,35)(H,36,37)/t14?,23?,27-/m1/s1 |
| InChIKey | WLXFPOLSPDOESB-GLUGUWRCSA-N |
| XLogP | 4.82 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|