C36H30F3N3O4 — CID 68953184
[4-[7,8-bis[methoxy-(3-methylphenyl)methyl]-3H-pyrazolo[5,4-c]isoquinolin-5-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 68953184) has the molecular formula C36H30F3N3O4 and a molecular weight of 625.65 g/mol. Its IUPAC name is [4-[7,8-bis[methoxy-(3-methylphenyl)methyl]-3H-pyrazolo[5,4-c]isoquinolin-5-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[7,8-bis[methoxy-(3-methylphenyl)methyl]-3H-pyrazolo[5,4-c]isoquinolin-5-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68953184 |
| Molecular Formula | C36H30F3N3O4 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | [4-[7,8-bis[methoxy-(3-methylphenyl)methyl]-3H-pyrazolo[5,4-c]isoquinolin-5-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COC(c1cccc(C)c1)c1cc2c(-c3ccc(OC(=O)C(F)(F)F)cc3)nc3[nH]ncc3c2cc1C(OC)c1cccc(C)c1 |
| InChI | InChI=1S/C36H30F3N3O4/c1-20-7-5-9-23(15-20)32(44-3)28-17-26-27(18-29(28)33(45-4)24-10-6-8-21(2)16-24)31(41-34-30(26)19-40-42-34)22-11-13-25(14-12-22)46-35(43)36(37,38)39/h5-19,32-33H,1-4H3,(H,40,41,42) |
| InChIKey | UNZRGTLQHHTMLP-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|