C12H19N3O2 — CID 68953760
2-amino-N,N-diethyl-3-hydroxy-3-pyridin-4-ylpropanamide (PubChem CID 68953760) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-3-hydroxy-3-pyridin-4-ylpropanamide.
| Compound Name | 2-amino-N,N-diethyl-3-hydroxy-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 68953760 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-amino-N,N-diethyl-3-hydroxy-3-pyridin-4-ylpropanamide |
| SMILES | CCN(CC)C(=O)C(N)C(O)c1ccncc1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-15(4-2)12(17)10(13)11(16)9-5-7-14-8-6-9/h5-8,10-11,16H,3-4,13H2,1-2H3 |
| InChIKey | BBHIRNDPVRMQPC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |