C11H14N2O5 — CID 135783884
(2S,4S)-2-amino-4-[hydroxy(pyridin-4-yl)methyl]pentanedioic acid (PubChem CID 135783884) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is (2S,4S)-2-amino-4-[hydroxy(pyridin-4-yl)methyl]pentanedioic acid.
| Compound Name | (2S,4S)-2-amino-4-[hydroxy(pyridin-4-yl)methyl]pentanedioic acid |
|---|---|
| PubChem CID | 135783884 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2S,4S)-2-amino-4-[hydroxy(pyridin-4-yl)methyl]pentanedioic acid |
| SMILES | N[C@@H](C[C@H](C(=O)O)C(O)c1ccncc1)C(=O)O |
| InChI | InChI=1S/C11H14N2O5/c12-8(11(17)18)5-7(10(15)16)9(14)6-1-3-13-4-2-6/h1-4,7-9,14H,5,12H2,(H,15,16)(H,17,18)/t7-,8-,9?/m0/s1 |
| InChIKey | VYKZFWLLOWQCFL-JVIMKECRSA-N |
| XLogP | -0.38 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |