About 2-aminobutanedioic acid;pyridine
2-aminobutanedioic acid;pyridine (PubChem CID 174825032) has the molecular formula C9H12N2O4
and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-aminobutanedioic acid;pyridine.
Molecular Properties
| Compound Name | 2-aminobutanedioic acid;pyridine |
| PubChem CID | 174825032 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-aminobutanedioic acid;pyridine |
| SMILES | NC(CC(=O)O)C(=O)O.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H7NO4/c1-2-4-6-5-3-1;5-2(4(8)9)1-3(6)7/h1-5H;2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | VPQMEMJYLQWTNY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminobutanedioic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanedioic acid;pyridine?
The IUPAC name of 2-aminobutanedioic acid;pyridine (CID 174825032) is 2-aminobutanedioic acid;pyridine.
What is the SMILES notation for 2-aminobutanedioic acid;pyridine?
The canonical SMILES for 2-aminobutanedioic acid;pyridine is NC(CC(=O)O)C(=O)O.c1ccncc1.
What is the InChIKey of 2-aminobutanedioic acid;pyridine?
The InChIKey is VPQMEMJYLQWTNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C4H7NO4/c1-2-4-6-5-3-1;5-2(4(8)9)1-3(6)7/h1-5H;2H,1,5H2,(H,6,7)(H,8,9).
What are the key properties of 2-aminobutanedioic acid;pyridine?
2-aminobutanedioic acid;pyridine has a molecular weight of 212.21 g/mol, XLogP of -0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanedioic acid;pyridine is sourced from PubChem (CID 174825032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).