C7H10F3NO5 — CID 43810878
2-amino-4-(2,2,2-trifluoro-1-hydroxyethyl)pentanedioic acid (PubChem CID 43810878) has the molecular formula C7H10F3NO5 and a molecular weight of 245.15 g/mol. Its IUPAC name is 2-amino-4-(2,2,2-trifluoro-1-hydroxyethyl)pentanedioic acid.
| Compound Name | 2-amino-4-(2,2,2-trifluoro-1-hydroxyethyl)pentanedioic acid |
|---|---|
| PubChem CID | 43810878 |
| Molecular Formula | C7H10F3NO5 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-amino-4-(2,2,2-trifluoro-1-hydroxyethyl)pentanedioic acid |
| SMILES | NC(CC(C(=O)O)C(O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H10F3NO5/c8-7(9,10)4(12)2(5(13)14)1-3(11)6(15)16/h2-4,12H,1,11H2,(H,13,14)(H,15,16) |
| InChIKey | XAMYXOTWXHQIPF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |