C5H7ClF3NO2S — CID 90711804
(2R)-2-amino-3-(1-chloro-2,2,2-trifluoroethyl)sulfanylpropanoic acid (PubChem CID 90711804) has the molecular formula C5H7ClF3NO2S and a molecular weight of 237.63 g/mol. Its IUPAC name is (2R)-2-amino-3-(1-chloro-2,2,2-trifluoroethyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(1-chloro-2,2,2-trifluoroethyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 90711804 |
| Molecular Formula | C5H7ClF3NO2S |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | (2R)-2-amino-3-(1-chloro-2,2,2-trifluoroethyl)sulfanylpropanoic acid |
| SMILES | N[C@@H](CSC(Cl)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C5H7ClF3NO2S/c6-4(5(7,8)9)13-1-2(10)3(11)12/h2,4H,1,10H2,(H,11,12)/t2-,4?/m0/s1 |
| InChIKey | FTYDNIDQSBROPL-PTLFGRINSA-N |
| XLogP | 1.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|