C5H8ClF2NO2S — CID 90883440
(2R)-2-amino-3-(2-chloro-1,1-difluoroethyl)sulfanylpropanoic acid (PubChem CID 90883440) has the molecular formula C5H8ClF2NO2S and a molecular weight of 219.64 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-chloro-1,1-difluoroethyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(2-chloro-1,1-difluoroethyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 90883440 |
| Molecular Formula | C5H8ClF2NO2S |
| Molecular Weight | 219.64 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | (2R)-2-amino-3-(2-chloro-1,1-difluoroethyl)sulfanylpropanoic acid |
| SMILES | N[C@@H](CSC(F)(F)CCl)C(=O)O |
| InChI | InChI=1S/C5H8ClF2NO2S/c6-2-5(7,8)12-1-3(9)4(10)11/h3H,1-2,9H2,(H,10,11)/t3-/m0/s1 |
| InChIKey | FNQAKSBIBYVXIG-VKHMYHEASA-N |
| XLogP | 0.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|