C23H18FNO2S — CID 68960030
4-[2-(1-benzothiophen-3-yl)ethyl]-2-(4-fluoroanilino)benzoic acid (PubChem CID 68960030) has the molecular formula C23H18FNO2S and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-3-yl)ethyl]-2-(4-fluoroanilino)benzoic acid.
| Compound Name | 4-[2-(1-benzothiophen-3-yl)ethyl]-2-(4-fluoroanilino)benzoic acid |
|---|---|
| PubChem CID | 68960030 |
| Molecular Formula | C23H18FNO2S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-[2-(1-benzothiophen-3-yl)ethyl]-2-(4-fluoroanilino)benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2csc3ccccc23)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FNO2S/c24-17-8-10-18(11-9-17)25-21-13-15(6-12-20(21)23(26)27)5-7-16-14-28-22-4-2-1-3-19(16)22/h1-4,6,8-14,25H,5,7H2,(H,26,27) |
| InChIKey | JHKYXOSZWDDDNH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |