C15H14ClN3O3 — CID 68960596
2-[3-[(2-chlorobenzoyl)amino]-4-methyl-1H-pyrazol-5-yl]but-3-enoic acid (PubChem CID 68960596) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is 2-[3-[(2-chlorobenzoyl)amino]-4-methyl-1H-pyrazol-5-yl]but-3-enoic acid.
| Compound Name | 2-[3-[(2-chlorobenzoyl)amino]-4-methyl-1H-pyrazol-5-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 68960596 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[3-[(2-chlorobenzoyl)amino]-4-methyl-1H-pyrazol-5-yl]but-3-enoic acid |
| SMILES | C=CC(C(=O)O)c1[nH]nc(NC(=O)c2ccccc2Cl)c1C |
| InChI | InChI=1S/C15H14ClN3O3/c1-3-9(15(21)22)12-8(2)13(19-18-12)17-14(20)10-6-4-5-7-11(10)16/h3-7,9H,1H2,2H3,(H,21,22)(H2,17,18,19,20) |
| InChIKey | LQYFQBRFYHATCE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|