C16H22N5O+ — CID 6896439
(1Z)-2-amino-2-(azepan-1-ium-1-ylidene)-N-(4-methoxyanilino)ethanimidoyl cyanide (PubChem CID 6896439) has the molecular formula C16H22N5O+ and a molecular weight of 300.39 g/mol. Its IUPAC name is (1Z)-2-amino-2-(azepan-1-ium-1-ylidene)-N-(4-methoxyanilino)ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-(azepan-1-ium-1-ylidene)-N-(4-methoxyanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 6896439 |
| Molecular Formula | C16H22N5O+ |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (1Z)-2-amino-2-(azepan-1-ium-1-ylidene)-N-(4-methoxyanilino)ethanimidoyl cyanide |
| SMILES | COc1ccc(N/N=C(/C#N)C(N)=[N+]2CCCCCC2)cc1 |
| InChI | InChI=1S/C16H21N5O/c1-22-14-8-6-13(7-9-14)19-20-15(12-17)16(18)21-10-4-2-3-5-11-21/h6-9H,2-5,10-11H2,1H3,(H2,18,19)/p+1 |
| InChIKey | HHEQQAALSSKJRM-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|