C15H15N5O2 — CID 72723211
(1E)-2-(3,5-dimethylpyrazol-1-yl)-N-(4-methoxyanilino)-2-oxoethanimidoyl cyanide (PubChem CID 72723211) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is (1E)-2-(3,5-dimethylpyrazol-1-yl)-N-(4-methoxyanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-(3,5-dimethylpyrazol-1-yl)-N-(4-methoxyanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 72723211 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (1E)-2-(3,5-dimethylpyrazol-1-yl)-N-(4-methoxyanilino)-2-oxoethanimidoyl cyanide |
| SMILES | COc1ccc(N/N=C(\C#N)C(=O)n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C15H15N5O2/c1-10-8-11(2)20(19-10)15(21)14(9-16)18-17-12-4-6-13(22-3)7-5-12/h4-8,17H,1-3H3/b18-14+ |
| InChIKey | NUEQYCLMDUTZIG-NBVRZTHBSA-N |
| XLogP | 2.14 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|