C19H16F4N4 — CID 68965607
2-N,5-bis[(3,4-difluorophenyl)methyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 68965607) has the molecular formula C19H16F4N4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-N,5-bis[(3,4-difluorophenyl)methyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N,5-bis[(3,4-difluorophenyl)methyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68965607 |
| Molecular Formula | C19H16F4N4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-N,5-bis[(3,4-difluorophenyl)methyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(NCc2ccc(F)c(F)c2)nc(N)c1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H16F4N4/c1-10-13(6-11-2-4-14(20)16(22)7-11)18(24)27-19(26-10)25-9-12-3-5-15(21)17(23)8-12/h2-5,7-8H,6,9H2,1H3,(H3,24,25,26,27) |
| InChIKey | NBYQPPSSMNXSJJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |