C30H35N3O8 — CID 68967040
[1-[4-[4-[[4-(2-methoxy-4-nitrophenoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]-2-methylpropan-2-yl] carbamate (PubChem CID 68967040) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is [1-[4-[4-[[4-(2-methoxy-4-nitrophenoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[4-[4-[[4-(2-methoxy-4-nitrophenoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 68967040 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | [1-[4-[4-[[4-(2-methoxy-4-nitrophenoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]-2-methylpropan-2-yl] carbamate |
| SMILES | COc1cc([N+](=O)[O-])ccc1Oc1ccc(COc2ccc(OC3CCN(CC(C)(C)OC(N)=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O8/c1-30(2,41-29(31)34)20-32-16-14-26(15-17-32)39-24-11-9-23(10-12-24)38-19-21-4-7-25(8-5-21)40-27-13-6-22(33(35)36)18-28(27)37-3/h4-13,18,26H,14-17,19-20H2,1-3H3,(H2,31,34) |
| InChIKey | QBELAYBBJBKTPN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|