C23H20ClF3N2O — CID 68967185
N-[(4-chlorophenyl)methyl]-2-phenyl-2-[[4-(trifluoromethyl)phenyl]methylamino]acetamide (PubChem CID 68967185) has the molecular formula C23H20ClF3N2O and a molecular weight of 432.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-phenyl-2-[[4-(trifluoromethyl)phenyl]methylamino]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-phenyl-2-[[4-(trifluoromethyl)phenyl]methylamino]acetamide |
|---|---|
| PubChem CID | 68967185 |
| Molecular Formula | C23H20ClF3N2O |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-phenyl-2-[[4-(trifluoromethyl)phenyl]methylamino]acetamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C(NCc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H20ClF3N2O/c24-20-12-8-17(9-13-20)15-29-22(30)21(18-4-2-1-3-5-18)28-14-16-6-10-19(11-7-16)23(25,26)27/h1-13,21,28H,14-15H2,(H,29,30) |
| InChIKey | JOAFXICILVMIGS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |