C27H32FN9S — CID 68969557
3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-fluorophenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 68969557) has the molecular formula C27H32FN9S and a molecular weight of 533.68 g/mol. Its IUPAC name is 3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-fluorophenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-fluorophenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 68969557 |
| Molecular Formula | C27H32FN9S |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-fluorophenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1csc2c(-n3nc(Nc4ccc(N5CCN([C@H]6C[C@@H]7CC[C@H]6C7)C(C)C5)c(F)c4)nc3N)ncnc12 |
| InChI | InChI=1S/C27H32FN9S/c1-15-13-38-24-23(15)30-14-31-25(24)37-26(29)33-27(34-37)32-19-5-6-21(20(28)11-19)35-7-8-36(16(2)12-35)22-10-17-3-4-18(22)9-17/h5-6,11,13-14,16-18,22H,3-4,7-10,12H2,1-2H3,(H3,29,32,33,34)/t16?,17-,18+,22+/m1/s1 |
| InChIKey | BKZUASXAMNWZSE-CUCNJXAHSA-N |
| XLogP | 4.74 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|