C28H35N9S — CID 69020479
3-N-[4-[(3R)-4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-methylphenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 69020479) has the molecular formula C28H35N9S and a molecular weight of 529.72 g/mol. Its IUPAC name is 3-N-[4-[(3R)-4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-methylphenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[(3R)-4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-methylphenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 69020479 |
| Molecular Formula | C28H35N9S |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 3-N-[4-[(3R)-4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-methylpiperazin-1-yl]-3-methylphenyl]-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1cc(Nc2nc(N)n(-c3ncnc4c(C)csc34)n2)ccc1N1CCN([C@H]2C[C@@H]3CC[C@H]2C3)[C@H](C)C1 |
| InChI | InChI=1S/C28H35N9S/c1-16-10-21(32-28-33-27(29)37(34-28)26-25-24(30-15-31-26)17(2)14-38-25)6-7-22(16)35-8-9-36(18(3)13-35)23-12-19-4-5-20(23)11-19/h6-7,10,14-15,18-20,23H,4-5,8-9,11-13H2,1-3H3,(H3,29,32,33,34)/t18-,19-,20+,23+/m1/s1 |
| InChIKey | CMYAMACWYJNQLI-UGTOYMOASA-N |
| XLogP | 4.91 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|