C26H30FN9S — CID 69269585
3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-3-fluorophenyl]-1-(4-methylthieno[2,3-d]pyridazin-7-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 69269585) has the molecular formula C26H30FN9S and a molecular weight of 519.65 g/mol. Its IUPAC name is 3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-3-fluorophenyl]-1-(4-methylthieno[2,3-d]pyridazin-7-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-3-fluorophenyl]-1-(4-methylthieno[2,3-d]pyridazin-7-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 69269585 |
| Molecular Formula | C26H30FN9S |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 3-N-[4-[4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-3-fluorophenyl]-1-(4-methylthieno[2,3-d]pyridazin-7-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1nnc(-n2nc(Nc3ccc(N4CCN([C@H]5C[C@@H]6CC[C@H]5C6)CC4)c(F)c3)nc2N)c2sccc12 |
| InChI | InChI=1S/C26H30FN9S/c1-15-19-6-11-37-23(19)24(32-31-15)36-25(28)30-26(33-36)29-18-4-5-21(20(27)14-18)34-7-9-35(10-8-34)22-13-16-2-3-17(22)12-16/h4-6,11,14,16-17,22H,2-3,7-10,12-13H2,1H3,(H3,28,29,30,33)/t16-,17+,22+/m1/s1 |
| InChIKey | PBUJUMUCYGGLBA-JLHGSKIFSA-N |
| XLogP | 4.36 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|