C28H39N5 — CID 68974455
3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1-phenyl-5-propylpyrazol-3-yl)methyl]propan-1-amine (PubChem CID 68974455) has the molecular formula C28H39N5 and a molecular weight of 445.66 g/mol. Its IUPAC name is 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1-phenyl-5-propylpyrazol-3-yl)methyl]propan-1-amine.
| Compound Name | 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1-phenyl-5-propylpyrazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 68974455 |
| Molecular Formula | C28H39N5 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(1-phenyl-5-propylpyrazol-3-yl)methyl]propan-1-amine |
| SMILES | CCCc1cc(CNCCCN2CCN(c3cccc(C)c3C)CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C28H39N5/c1-4-10-27-21-25(30-33(27)26-12-6-5-7-13-26)22-29-15-9-16-31-17-19-32(20-18-31)28-14-8-11-23(2)24(28)3/h5-8,11-14,21,29H,4,9-10,15-20,22H2,1-3H3 |
| InChIKey | NOQRCAZGGZTAJX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|