C27H37ClN4 — CID 71766546
1-(3,4-dimethylphenyl)-4-[3-(1-phenyl-3-propylpyrazol-5-yl)propyl]piperazine;hydrochloride (PubChem CID 71766546) has the molecular formula C27H37ClN4 and a molecular weight of 453.07 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-[3-(1-phenyl-3-propylpyrazol-5-yl)propyl]piperazine;hydrochloride.
| Compound Name | 1-(3,4-dimethylphenyl)-4-[3-(1-phenyl-3-propylpyrazol-5-yl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 71766546 |
| Molecular Formula | C27H37ClN4 |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-[3-(1-phenyl-3-propylpyrazol-5-yl)propyl]piperazine;hydrochloride |
| SMILES | CCCc1cc(CCCN2CCN(c3ccc(C)c(C)c3)CC2)n(-c2ccccc2)n1.Cl |
| InChI | InChI=1S/C27H36N4.ClH/c1-4-9-24-21-27(31(28-24)25-10-6-5-7-11-25)12-8-15-29-16-18-30(19-17-29)26-14-13-22(2)23(3)20-26;/h5-7,10-11,13-14,20-21H,4,8-9,12,15-19H2,1-3H3;1H |
| InChIKey | YLMXLNLWHWADMH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|