C32H42F2N4O3 — CID 68978869
tert-butyl N-[(3S)-4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamate (PubChem CID 68978869) has the molecular formula C32H42F2N4O3 and a molecular weight of 568.71 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 68978869 |
| Molecular Formula | C32H42F2N4O3 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | tert-butyl N-[(3S)-4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(F)cc(F)c1)[C@@H](O)CNC1(c2cccc(C(C)(C)C)c2)CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C32H42F2N4O3/c1-30(2,3)22-8-7-9-23(15-22)32(11-10-26-21(17-32)18-36-38-26)35-19-28(39)27(37-29(40)41-31(4,5)6)14-20-12-24(33)16-25(34)13-20/h7-9,12-13,15-16,18,27-28,35,39H,10-11,14,17,19H2,1-6H3,(H,36,38)(H,37,40)/t27?,28-,32?/m0/s1 |
| InChIKey | LIEXXEJPZOLJPM-PFOYYZJDSA-N |
| XLogP | 5.46 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |