C28H36F2N4O2S — CID 70330163
N-[4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]methanesulfinamide (PubChem CID 70330163) has the molecular formula C28H36F2N4O2S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]methanesulfinamide.
| Compound Name | N-[4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]methanesulfinamide |
|---|---|
| PubChem CID | 70330163 |
| Molecular Formula | C28H36F2N4O2S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-[4-[[5-(3-tert-butylphenyl)-1,4,6,7-tetrahydroindazol-5-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]methanesulfinamide |
| SMILES | CS(=O)NC(Cc1cc(F)cc(F)c1)C(O)CNC1(c2cccc(C(C)(C)C)c2)CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C28H36F2N4O2S/c1-27(2,3)20-6-5-7-21(13-20)28(9-8-24-19(15-28)16-32-33-24)31-17-26(35)25(34-37(4)36)12-18-10-22(29)14-23(30)11-18/h5-7,10-11,13-14,16,25-26,31,34-35H,8-9,12,15,17H2,1-4H3,(H,32,33) |
| InChIKey | SEIINBGCOVWDLV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |