C29H28N2O5 — CID 68982209
4-[3-[2-(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)ethoxy]phenoxy]butanoic acid (PubChem CID 68982209) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is 4-[3-[2-(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)ethoxy]phenoxy]butanoic acid.
| Compound Name | 4-[3-[2-(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)ethoxy]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 68982209 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 4-[3-[2-(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)ethoxy]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(OCCc2cc(=O)[nH]nc2C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H28N2O5/c32-26-19-23(16-18-36-25-14-7-13-24(20-25)35-17-8-15-27(33)34)29(31-30-26)28(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-7,9-14,19-20,28H,8,15-18H2,(H,30,32)(H,33,34) |
| InChIKey | IBAABAQPQFRSCS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|