C31H31NO4S — CID 68981097
4-[3-[3-(5-benzhydryl-2-oxo-1H-pyridin-3-yl)propylsulfanyl]phenoxy]butanoic acid (PubChem CID 68981097) has the molecular formula C31H31NO4S and a molecular weight of 513.66 g/mol. Its IUPAC name is 4-[3-[3-(5-benzhydryl-2-oxo-1H-pyridin-3-yl)propylsulfanyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[3-(5-benzhydryl-2-oxo-1H-pyridin-3-yl)propylsulfanyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 68981097 |
| Molecular Formula | C31H31NO4S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 4-[3-[3-(5-benzhydryl-2-oxo-1H-pyridin-3-yl)propylsulfanyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(SCCCc2cc(C(c3ccccc3)c3ccccc3)c[nH]c2=O)c1 |
| InChI | InChI=1S/C31H31NO4S/c33-29(34)17-8-18-36-27-15-7-16-28(21-27)37-19-9-14-25-20-26(22-32-31(25)35)30(23-10-3-1-4-11-23)24-12-5-2-6-13-24/h1-7,10-13,15-16,20-22,30H,8-9,14,17-19H2,(H,32,35)(H,33,34) |
| InChIKey | KJVXFUJMVYJQKE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|