C31H31NO4S — CID 91023567
ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]acetate (PubChem CID 91023567) has the molecular formula C31H31NO4S and a molecular weight of 513.66 g/mol. Its IUPAC name is ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 91023567 |
| Molecular Formula | C31H31NO4S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | ethyl 2-[3-[3-(5-benzhydryl-2-oxo-1-pyridinyl)propylsulfanyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(SCCCn2cc(C(c3ccccc3)c3ccccc3)ccc2=O)c1 |
| InChI | InChI=1S/C31H31NO4S/c1-2-35-30(34)23-36-27-15-9-16-28(21-27)37-20-10-19-32-22-26(17-18-29(32)33)31(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-9,11-18,21-22,31H,2,10,19-20,23H2,1H3 |
| InChIKey | HVRYRXCJZXTODI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|