C31H31NO7 — CID 59145184
2-[3-[3-[5-[bis(4-methoxyphenyl)methyl]-2-oxo-1-pyridinyl]propoxy]phenoxy]acetic acid (PubChem CID 59145184) has the molecular formula C31H31NO7 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-[3-[3-[5-[bis(4-methoxyphenyl)methyl]-2-oxo-1-pyridinyl]propoxy]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-[5-[bis(4-methoxyphenyl)methyl]-2-oxo-1-pyridinyl]propoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 59145184 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2-[3-[3-[5-[bis(4-methoxyphenyl)methyl]-2-oxo-1-pyridinyl]propoxy]phenoxy]acetic acid |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)c2ccc(=O)n(CCCOc3cccc(OCC(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C31H31NO7/c1-36-25-12-7-22(8-13-25)31(23-9-14-26(37-2)15-10-23)24-11-16-29(33)32(20-24)17-4-18-38-27-5-3-6-28(19-27)39-21-30(34)35/h3,5-16,19-20,31H,4,17-18,21H2,1-2H3,(H,34,35) |
| InChIKey | TVQCYFSQVMZYRH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|