C31H31NO4 — CID 59145329
(2S)-2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]propanoic acid (PubChem CID 59145329) has the molecular formula C31H31NO4 and a molecular weight of 481.59 g/mol. Its IUPAC name is (2S)-2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 59145329 |
| Molecular Formula | C31H31NO4 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | (2S)-2-[3-[4-(5-benzhydryl-2-oxo-1-pyridinyl)butyl]phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1cccc(CCCCn2cc(C(c3ccccc3)c3ccccc3)ccc2=O)c1)C(=O)O |
| InChI | InChI=1S/C31H31NO4/c1-23(31(34)35)36-28-17-10-12-24(21-28)11-8-9-20-32-22-27(18-19-29(32)33)30(25-13-4-2-5-14-25)26-15-6-3-7-16-26/h2-7,10,12-19,21-23,30H,8-9,11,20H2,1H3,(H,34,35)/t23-/m0/s1 |
| InChIKey | BWKHBSWZTWJDQU-QHCPKHFHSA-N |
| XLogP | 5.90 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|